C36H41Cl2FN4O6S — CID 162672892
N'-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide (PubChem CID 162672892) has the molecular formula C36H41Cl2FN4O6S and a molecular weight of 747.72 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide.
| Compound Name | N'-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide |
|---|---|
| PubChem CID | 162672892 |
| Molecular Formula | C36H41Cl2FN4O6S |
| Molecular Weight | 747.72 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide |
| SMILES | COCC/C(=N\S(=O)(=O)Cc1ccc(Cl)c(Cl)c1)Nc1ccc(Oc2ccnc3cc(OCCCN4CCC(C)CC4)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C36H41Cl2FN4O6S/c1-24-10-15-43(16-11-24)14-4-17-48-35-22-31-27(21-34(35)47-3)32(9-13-40-31)49-33-8-6-26(20-30(33)39)41-36(12-18-46-2)42-50(44,45)23-25-5-7-28(37)29(38)19-25/h5-9,13,19-22,24H,4,10-12,14-18,23H2,1-3H3,(H,41,42) |
| InChIKey | BNEFKXHQRXFMAV-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.72 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|