C25H23FN2O5S — CID 11271621
4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoro-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 11271621) has the molecular formula C25H23FN2O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoro-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoro-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11271621 |
| Molecular Formula | C25H23FN2O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluoro-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | COc1cc2nccc(Oc3ccc(S(=O)(=O)NCCc4ccccc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C25H23FN2O5S/c1-31-24-15-19-21(16-25(24)32-2)27-12-11-22(19)33-23-9-8-18(14-20(23)26)34(29,30)28-13-10-17-6-4-3-5-7-17/h3-9,11-12,14-16,28H,10,13H2,1-2H3 |
| InChIKey | INHSKSLKIOVZAH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |