C27H25FN3O4+ — CID 87237886
1-benzyl-1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]imidazolidin-1-ium-2-one (PubChem CID 87237886) has the molecular formula C27H25FN3O4+ and a molecular weight of 474.51 g/mol. Its IUPAC name is 1-benzyl-1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]imidazolidin-1-ium-2-one.
| Compound Name | 1-benzyl-1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]imidazolidin-1-ium-2-one |
|---|---|
| PubChem CID | 87237886 |
| Molecular Formula | C27H25FN3O4+ |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-benzyl-1-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]imidazolidin-1-ium-2-one |
| SMILES | COc1cc2nccc(Oc3ccc([N+]4(Cc5ccccc5)CCNC4=O)cc3F)c2cc1OC |
| InChI | InChI=1S/C27H24FN3O4/c1-33-25-15-20-22(16-26(25)34-2)29-11-10-23(20)35-24-9-8-19(14-21(24)28)31(13-12-30-27(31)32)17-18-6-4-3-5-7-18/h3-11,14-16H,12-13,17H2,1-2H3/p+1 |
| InChIKey | IJTWPDSXMYZVJB-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|