C35H36FN5O5 — CID 154379885
[[1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-hydroxy-2H-naphthalen-1-yl]methylideneamino]urea (PubChem CID 154379885) has the molecular formula C35H36FN5O5 and a molecular weight of 625.70 g/mol. Its IUPAC name is [[1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-hydroxy-2H-naphthalen-1-yl]methylideneamino]urea.
| Compound Name | [[1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-hydroxy-2H-naphthalen-1-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 154379885 |
| Molecular Formula | C35H36FN5O5 |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | [[1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-hydroxy-2H-naphthalen-1-yl]methylideneamino]urea |
| SMILES | COc1cc2c(Oc3ccc(C4(C=NNC(N)=O)c5ccccc5C=CC4O)cc3F)ccnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C35H36FN5O5/c1-44-31-20-25-28(21-32(31)45-18-6-17-41-15-4-5-16-41)38-14-13-29(25)46-30-11-10-24(19-27(30)36)35(22-39-40-34(37)43)26-8-3-2-7-23(26)9-12-33(35)42/h2-3,7-14,19-22,33,42H,4-6,15-18H2,1H3,(H3,37,40,43) |
| InChIKey | DSEOHHOCWHDWEC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|