C35H36F4N4O4 — CID 90646920
2-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]acetamide (PubChem CID 90646920) has the molecular formula C35H36F4N4O4 and a molecular weight of 652.69 g/mol. Its IUPAC name is 2-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 90646920 |
| Molecular Formula | C35H36F4N4O4 |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 2-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]acetamide |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)N/N=C(\C)c4ccc(C(F)(F)F)cc4)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C35H36F4N4O4/c1-23(25-8-10-26(11-9-25)35(37,38)39)41-42-34(44)20-24-7-12-31(28(36)19-24)47-30-13-14-40-29-22-33(32(45-2)21-27(29)30)46-18-6-17-43-15-4-3-5-16-43/h7-14,19,21-22H,3-6,15-18,20H2,1-2H3,(H,42,44)/b41-23+ |
| InChIKey | OAZGFRFNDUWGJE-WSBIKYRQSA-N |
| XLogP | 7.53 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|