C39H37F2N5O4 — CID 144548513
8-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-2-[(4-fluorophenyl)methyl]-2,7-naphthyridin-1-one (PubChem CID 144548513) has the molecular formula C39H37F2N5O4 and a molecular weight of 677.75 g/mol. Its IUPAC name is 8-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-2-[(4-fluorophenyl)methyl]-2,7-naphthyridin-1-one.
| Compound Name | 8-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-2-[(4-fluorophenyl)methyl]-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 144548513 |
| Molecular Formula | C39H37F2N5O4 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 8-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]-2-[(4-fluorophenyl)methyl]-2,7-naphthyridin-1-one |
| SMILES | COc1cc2c(Oc3ccc(Nc4nccc5ccn(Cc6ccc(F)cc6)c(=O)c45)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C39H37F2N5O4/c1-48-35-23-30-32(24-36(35)49-21-5-19-45-17-3-2-4-18-45)42-16-13-33(30)50-34-11-10-29(22-31(34)41)44-38-37-27(12-15-43-38)14-20-46(39(37)47)25-26-6-8-28(40)9-7-26/h6-16,20,22-24H,2-5,17-19,21,25H2,1H3,(H,43,44) |
| InChIKey | GUPARFVBBXBGDY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|