C38H33F2N5O5 — CID 118705810
N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(3-fluorophenyl)-4-oxophthalazine-1-carboxamide (PubChem CID 118705810) has the molecular formula C38H33F2N5O5 and a molecular weight of 677.71 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(3-fluorophenyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(3-fluorophenyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 118705810 |
| Molecular Formula | C38H33F2N5O5 |
| Molecular Weight | 677.71 g/mol |
| Exact Mass | 677.24 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(3-fluorophenyl)-4-oxophthalazine-1-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4nn(-c5cccc(F)c5)c(=O)c5ccccc45)cc3F)ccnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C38H33F2N5O5/c1-48-34-22-29-31(23-35(34)49-19-7-18-44-16-4-5-17-44)41-15-14-32(29)50-33-13-12-25(21-30(33)40)42-37(46)36-27-10-2-3-11-28(27)38(47)45(43-36)26-9-6-8-24(39)20-26/h2-3,6,8-15,20-23H,4-5,7,16-19H2,1H3,(H,42,46) |
| InChIKey | UJWCNUHITLVMJO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|