C32H33Cl2FN6O3S — CID 71680365
1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]thiourea (PubChem CID 71680365) has the molecular formula C32H33Cl2FN6O3S and a molecular weight of 671.63 g/mol. Its IUPAC name is 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]thiourea.
| Compound Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]thiourea |
|---|---|
| PubChem CID | 71680365 |
| Molecular Formula | C32H33Cl2FN6O3S |
| Molecular Weight | 671.63 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]thiourea |
| SMILES | COc1cc2c(Oc3ccc(NC(=S)N/N=C/c4ccc(Cl)cc4Cl)cc3F)ccnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C32H33Cl2FN6O3S/c1-40-11-13-41(14-12-40)10-3-15-43-31-19-27-24(18-30(31)42-2)28(8-9-36-27)44-29-7-6-23(17-26(29)35)38-32(45)39-37-20-21-4-5-22(33)16-25(21)34/h4-9,16-20H,3,10-15H2,1-2H3,(H2,38,39,45)/b37-20+ |
| InChIKey | PNVQOJBQYGAUFP-HASSKWOGSA-N |
| XLogP | 6.82 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|