C32H34ClFN6O3S — CID 154132809
1-(4-chlorophenyl)-1-[[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]thiourea (PubChem CID 154132809) has the molecular formula C32H34ClFN6O3S and a molecular weight of 637.18 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-[[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-1-[[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 154132809 |
| Molecular Formula | C32H34ClFN6O3S |
| Molecular Weight | 637.18 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 1-(4-chlorophenyl)-1-[[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]thiourea |
| SMILES | COc1cc2c(Oc3ccc(C=NN(C(N)=S)c4ccc(Cl)cc4)cc3F)ccnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C32H34ClFN6O3S/c1-38-13-15-39(16-14-38)12-3-17-42-31-20-27-25(19-30(31)41-2)28(10-11-36-27)43-29-9-4-22(18-26(29)34)21-37-40(32(35)44)24-7-5-23(33)6-8-24/h4-11,18-21H,3,12-17H2,1-2H3,(H2,35,44) |
| InChIKey | SYZWMOABKDTFQE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.18 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|