C34H36FN5O5 — CID 138961740
1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]urea (PubChem CID 138961740) has the molecular formula C34H36FN5O5 and a molecular weight of 613.69 g/mol. Its IUPAC name is 1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]urea.
| Compound Name | 1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 138961740 |
| Molecular Formula | C34H36FN5O5 |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 1-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]urea |
| SMILES | C=CCc1cccc(/C=N/N(C(N)=O)c2ccc(Oc3ccnc4cc(OCCCN5CCCC5)c(OC)cc34)c(F)c2)c1O |
| InChI | InChI=1S/C34H36FN5O5/c1-3-8-23-9-6-10-24(33(23)41)22-38-40(34(36)42)25-11-12-30(27(35)19-25)45-29-13-14-37-28-21-32(31(43-2)20-26(28)29)44-18-7-17-39-15-4-5-16-39/h3,6,9-14,19-22,41H,1,4-5,7-8,15-18H2,2H3,(H2,36,42)/b38-22+ |
| InChIKey | OIAHLJIVGDCRBP-NNLKUIAGSA-N |
| XLogP | 6.39 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|