C32H31F4N5O5 — CID 154114272
1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[[3-(trifluoromethyl)phenyl]methylideneamino]urea (PubChem CID 154114272) has the molecular formula C32H31F4N5O5 and a molecular weight of 641.62 g/mol. Its IUPAC name is 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[[3-(trifluoromethyl)phenyl]methylideneamino]urea.
| Compound Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[[3-(trifluoromethyl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 154114272 |
| Molecular Formula | C32H31F4N5O5 |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[[3-(trifluoromethyl)phenyl]methylideneamino]urea |
| SMILES | COc1cc2c(Oc3ccc(N(N=Cc4cccc(C(F)(F)F)c4)C(N)=O)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C32H31F4N5O5/c1-43-29-18-24-26(19-30(29)45-13-3-10-40-11-14-44-15-12-40)38-9-8-27(24)46-28-7-6-23(17-25(28)33)41(31(37)42)39-20-21-4-2-5-22(16-21)32(34,35)36/h2,4-9,16-20H,3,10-15H2,1H3,(H2,37,42) |
| InChIKey | YJZXHVWBUDIUKV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|