C31H31FN6O6S — CID 138961743
1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-nitrophenyl)methylideneamino]thiourea (PubChem CID 138961743) has the molecular formula C31H31FN6O6S and a molecular weight of 634.69 g/mol. Its IUPAC name is 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 138961743 |
| Molecular Formula | C31H31FN6O6S |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-[(E)-(2-nitrophenyl)methylideneamino]thiourea |
| SMILES | COc1cc2c(Oc3ccc(N(/N=C/c4ccccc4[N+](=O)[O-])C(N)=S)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C31H31FN6O6S/c1-41-29-18-23-25(19-30(29)43-14-4-11-36-12-15-42-16-13-36)34-10-9-27(23)44-28-8-7-22(17-24(28)32)37(31(33)45)35-20-21-5-2-3-6-26(21)38(39)40/h2-3,5-10,17-20H,4,11-16H2,1H3,(H2,33,45)/b35-20+ |
| InChIKey | HVIIDMOLRDULBW-JEPNHJGPSA-N |
| XLogP | 5.27 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|