C34H35FN4O6 — CID 11858370
1-benzyl-4-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]piperazine-2,5-dione (PubChem CID 11858370) has the molecular formula C34H35FN4O6 and a molecular weight of 614.67 g/mol. Its IUPAC name is 1-benzyl-4-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]piperazine-2,5-dione.
| Compound Name | 1-benzyl-4-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 11858370 |
| Molecular Formula | C34H35FN4O6 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 1-benzyl-4-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]piperazine-2,5-dione |
| SMILES | COc1cc2c(Oc3ccc(N4CC(=O)N(Cc5ccccc5)CC4=O)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H35FN4O6/c1-42-31-19-26-28(20-32(31)44-15-5-12-37-13-16-43-17-14-37)36-11-10-29(26)45-30-9-8-25(18-27(30)35)39-23-33(40)38(22-34(39)41)21-24-6-3-2-4-7-24/h2-4,6-11,18-20H,5,12-17,21-23H2,1H3 |
| InChIKey | RKQJFKDJDBEMPM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|