C35H34FN3O5 — CID 24865419
6-benzyl-3-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1H-pyridin-2-one (PubChem CID 24865419) has the molecular formula C35H34FN3O5 and a molecular weight of 595.67 g/mol. Its IUPAC name is 6-benzyl-3-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1H-pyridin-2-one.
| Compound Name | 6-benzyl-3-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 24865419 |
| Molecular Formula | C35H34FN3O5 |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | 6-benzyl-3-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1H-pyridin-2-one |
| SMILES | COc1cc2c(Oc3ccc(-c4ccc(Cc5ccccc5)[nH]c4=O)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C35H34FN3O5/c1-41-33-22-28-30(23-34(33)43-17-5-14-39-15-18-42-19-16-39)37-13-12-31(28)44-32-11-8-25(21-29(32)36)27-10-9-26(38-35(27)40)20-24-6-3-2-4-7-24/h2-4,6-13,21-23H,5,14-20H2,1H3,(H,38,40) |
| InChIKey | WRPWIMUEGZEMOX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|