C35H36FN5O5 — CID 24865972
2-anilino-3-ethyl-5-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]pyrimidin-4-one (PubChem CID 24865972) has the molecular formula C35H36FN5O5 and a molecular weight of 625.70 g/mol. Its IUPAC name is 2-anilino-3-ethyl-5-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]pyrimidin-4-one.
| Compound Name | 2-anilino-3-ethyl-5-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 24865972 |
| Molecular Formula | C35H36FN5O5 |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | 2-anilino-3-ethyl-5-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]pyrimidin-4-one |
| SMILES | CCn1c(Nc2ccccc2)ncc(-c2ccc(Oc3ccnc4cc(OCCCN5CCOCC5)c(OC)cc34)c(F)c2)c1=O |
| InChI | InChI=1S/C35H36FN5O5/c1-3-41-34(42)27(23-38-35(41)39-25-8-5-4-6-9-25)24-10-11-31(28(36)20-24)46-30-12-13-37-29-22-33(32(43-2)21-26(29)30)45-17-7-14-40-15-18-44-19-16-40/h4-6,8-13,20-23H,3,7,14-19H2,1-2H3,(H,38,39) |
| InChIKey | SWEWZOSVNQXGKK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|