C19H23ClN4O3 — CID 109185866
N-(3-chloro-4-methoxyphenyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide (PubChem CID 109185866) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109185866 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NCCN3CCOCC3)cn2)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O3/c1-26-18-5-3-14(12-16(18)20)23-19(25)17-4-2-15(13-22-17)21-6-7-24-8-10-27-11-9-24/h2-5,12-13,21H,6-11H2,1H3,(H,23,25) |
| InChIKey | ZBLDKCUEAIZKOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |