C18H20Cl2N4O2 — CID 109207703
N-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide (PubChem CID 109207703) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109207703 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(NCCN2CCOCC2)ccn1 |
| InChI | InChI=1S/C18H20Cl2N4O2/c19-15-2-1-14(11-16(15)20)23-18(25)17-12-13(3-4-22-17)21-5-6-24-7-9-26-10-8-24/h1-4,11-12H,5-10H2,(H,21,22)(H,23,25) |
| InChIKey | XMSADWRXYBMBTB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |