C20H25FN4O2 — CID 109207606
N-[2-(2-fluorophenyl)ethyl]-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide (PubChem CID 109207606) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109207606 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-4-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1cc(NCCN2CCOCC2)ccn1 |
| InChI | InChI=1S/C20H25FN4O2/c21-18-4-2-1-3-16(18)5-7-24-20(26)19-15-17(6-8-23-19)22-9-10-25-11-13-27-14-12-25/h1-4,6,8,15H,5,7,9-14H2,(H,22,23)(H,24,26) |
| InChIKey | KJUHGGKMHGEVJC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |