C15H24N4O3 — CID 109183829
N-(2-methoxyethyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide (PubChem CID 109183829) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109183829 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-(2-methoxyethyl)-5-(2-morpholin-4-ylethylamino)pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NCCN2CCOCC2)cn1 |
| InChI | InChI=1S/C15H24N4O3/c1-21-9-5-17-15(20)14-3-2-13(12-18-14)16-4-6-19-7-10-22-11-8-19/h2-3,12,16H,4-11H2,1H3,(H,17,20) |
| InChIKey | PNMQPGKWPOQHFE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|