C25H28N4O6 — CID 50771349
3,5-dimethoxy-N-[N'-(pyridin-4-ylmethyl)-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]benzamide (PubChem CID 50771349) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[N'-(pyridin-4-ylmethyl)-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[N'-(pyridin-4-ylmethyl)-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50771349 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3,5-dimethoxy-N-[N'-(pyridin-4-ylmethyl)-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\Cc2ccncc2)Nc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H28N4O6/c1-31-19-10-17(11-20(14-19)32-2)24(30)29-25(27-15-16-6-8-26-9-7-16)28-18-12-21(33-3)23(35-5)22(13-18)34-4/h6-14H,15H2,1-5H3,(H2,27,28,29,30) |
| InChIKey | ZYJGEHNPMFXHOK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|