C23H20N4O5 — CID 50771138
methyl 3-[[N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]amino]benzoate (PubChem CID 50771138) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is methyl 3-[[N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]amino]benzoate.
| Compound Name | methyl 3-[[N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 50771138 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 3-[[N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N/C(=N/Cc2ccncc2)NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H20N4O5/c1-30-22(29)17-3-2-4-18(11-17)26-23(25-13-15-7-9-24-10-8-15)27-21(28)16-5-6-19-20(12-16)32-14-31-19/h2-12H,13-14H2,1H3,(H2,25,26,27,28) |
| InChIKey | OJLVYHULKQMTCS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|