C19H16ClN3O2 — CID 139243358
N-[N-(4-chlorophenyl)-N'-(furan-2-ylmethyl)carbamimidoyl]benzamide (PubChem CID 139243358) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is N-[N-(4-chlorophenyl)-N'-(furan-2-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | N-[N-(4-chlorophenyl)-N'-(furan-2-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 139243358 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[N-(4-chlorophenyl)-N'-(furan-2-ylmethyl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1ccco1)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16ClN3O2/c20-15-8-10-16(11-9-15)22-19(21-13-17-7-4-12-25-17)23-18(24)14-5-2-1-3-6-14/h1-12H,13H2,(H2,21,22,23,24) |
| InChIKey | AXBNPVGUKMJVPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|