C38H35N3O3 — CID 87328446
1,5-diphenyl-1-N,3-N,5-N-tris(phenylmethoxy)pentane-1,3,5-triimine (PubChem CID 87328446) has the molecular formula C38H35N3O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is 1,5-diphenyl-1-N,3-N,5-N-tris(phenylmethoxy)pentane-1,3,5-triimine.
| Compound Name | 1,5-diphenyl-1-N,3-N,5-N-tris(phenylmethoxy)pentane-1,3,5-triimine |
|---|---|
| PubChem CID | 87328446 |
| Molecular Formula | C38H35N3O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 1,5-diphenyl-1-N,3-N,5-N-tris(phenylmethoxy)pentane-1,3,5-triimine |
| SMILES | c1ccc(CON=C(CC(=NOCc2ccccc2)c2ccccc2)CC(=NOCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H35N3O3/c1-6-16-31(17-7-1)28-42-39-36(26-37(34-22-12-4-13-23-34)40-43-29-32-18-8-2-9-19-32)27-38(35-24-14-5-15-25-35)41-44-30-33-20-10-3-11-21-33/h1-25H,26-30H2 |
| InChIKey | AFHOJSDIGGFASJ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|