C31H28N2O3 — CID 88532089
(3Z,5E)-1,5-diphenyl-3,5-bis(phenylmethoxyimino)pentan-1-one (PubChem CID 88532089) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is (3Z,5E)-1,5-diphenyl-3,5-bis(phenylmethoxyimino)pentan-1-one.
| Compound Name | (3Z,5E)-1,5-diphenyl-3,5-bis(phenylmethoxyimino)pentan-1-one |
|---|---|
| PubChem CID | 88532089 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (3Z,5E)-1,5-diphenyl-3,5-bis(phenylmethoxyimino)pentan-1-one |
| SMILES | O=C(C/C(C/C(=N\OCc1ccccc1)c1ccccc1)=N\OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28N2O3/c34-31(28-19-11-4-12-20-28)22-29(32-35-23-25-13-5-1-6-14-25)21-30(27-17-9-3-10-18-27)33-36-24-26-15-7-2-8-16-26/h1-20H,21-24H2/b32-29-,33-30+ |
| InChIKey | RXZRAWWGVXJERM-IUNIZMNESA-N |
| XLogP | 6.84 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|