C12H12N2OS — CID 173292936
N-methoxy-1-phenyl-2-(1,3-thiazol-2-yl)ethanimine (PubChem CID 173292936) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is N-methoxy-1-phenyl-2-(1,3-thiazol-2-yl)ethanimine.
| Compound Name | N-methoxy-1-phenyl-2-(1,3-thiazol-2-yl)ethanimine |
|---|---|
| PubChem CID | 173292936 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | N-methoxy-1-phenyl-2-(1,3-thiazol-2-yl)ethanimine |
| SMILES | CON=C(Cc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2OS/c1-15-14-11(9-12-13-7-8-16-12)10-5-3-2-4-6-10/h2-8H,9H2,1H3 |
| InChIKey | FAZUNQZSIYZBFM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|