C13H18N2O2 — CID 59967575
1-(4-ethylphenyl)-1-N,2-N-dimethoxypropane-1,2-diimine (PubChem CID 59967575) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-1-N,2-N-dimethoxypropane-1,2-diimine.
| Compound Name | 1-(4-ethylphenyl)-1-N,2-N-dimethoxypropane-1,2-diimine |
|---|---|
| PubChem CID | 59967575 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(4-ethylphenyl)-1-N,2-N-dimethoxypropane-1,2-diimine |
| SMILES | CCc1ccc(C(=N\OC)/C(C)=N/OC)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-5-11-6-8-12(9-7-11)13(15-17-4)10(2)14-16-3/h6-9H,5H2,1-4H3/b14-10+,15-13- |
| InChIKey | NYPOSONSFBYZQL-BZTGPAQBSA-N |
| XLogP | 2.62 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|