C16H19N3O3 — CID 59967596
1-[4-(3-ethyl-1,2-oxazol-4-yl)phenyl]-1-N,2-N-dimethoxypropane-1,2-diimine (PubChem CID 59967596) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[4-(3-ethyl-1,2-oxazol-4-yl)phenyl]-1-N,2-N-dimethoxypropane-1,2-diimine.
| Compound Name | 1-[4-(3-ethyl-1,2-oxazol-4-yl)phenyl]-1-N,2-N-dimethoxypropane-1,2-diimine |
|---|---|
| PubChem CID | 59967596 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[4-(3-ethyl-1,2-oxazol-4-yl)phenyl]-1-N,2-N-dimethoxypropane-1,2-diimine |
| SMILES | CCc1nocc1-c1ccc(C(=N\OC)/C(C)=N/OC)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-5-15-14(10-22-18-15)12-6-8-13(9-7-12)16(19-21-4)11(2)17-20-3/h6-10H,5H2,1-4H3/b17-11+,19-16- |
| InChIKey | JJTCSBZTHSUITG-IIIOKWFNSA-N |
| XLogP | 3.28 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|