C12H15BrN2O2 — CID 20684356
1-(4-bromophenyl)-1-N-ethoxy-2-N-methoxypropane-1,2-diimine (PubChem CID 20684356) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-N-ethoxy-2-N-methoxypropane-1,2-diimine.
| Compound Name | 1-(4-bromophenyl)-1-N-ethoxy-2-N-methoxypropane-1,2-diimine |
|---|---|
| PubChem CID | 20684356 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(4-bromophenyl)-1-N-ethoxy-2-N-methoxypropane-1,2-diimine |
| SMILES | CCO/N=C(C(\C)=N\OC)/c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrN2O2/c1-4-17-15-12(9(2)14-16-3)10-5-7-11(13)8-6-10/h5-8H,4H2,1-3H3/b14-9+,15-12+ |
| InChIKey | BLLREPLCZBCGKF-WKDANBKTSA-N |
| XLogP | 3.21 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|