C17H19N2O3PS — CID 72538440
2-methoxyimino-N-[[methyl(phenylsulfanyl)phosphoryl]methyl]-2-phenylacetamide (PubChem CID 72538440) has the molecular formula C17H19N2O3PS and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-methoxyimino-N-[[methyl(phenylsulfanyl)phosphoryl]methyl]-2-phenylacetamide.
| Compound Name | 2-methoxyimino-N-[[methyl(phenylsulfanyl)phosphoryl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 72538440 |
| Molecular Formula | C17H19N2O3PS |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-methoxyimino-N-[[methyl(phenylsulfanyl)phosphoryl]methyl]-2-phenylacetamide |
| SMILES | CON=C(C(=O)NCP(C)(=O)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N2O3PS/c1-22-19-16(14-9-5-3-6-10-14)17(20)18-13-23(2,21)24-15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,18,20) |
| InChIKey | NGRBONYHKJYJOI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|