C13H15NO3S — CID 90854139
(4Z)-4-methoxyimino-1-phenylsulfanylhexane-2,5-dione (PubChem CID 90854139) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is (4Z)-4-methoxyimino-1-phenylsulfanylhexane-2,5-dione.
| Compound Name | (4Z)-4-methoxyimino-1-phenylsulfanylhexane-2,5-dione |
|---|---|
| PubChem CID | 90854139 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (4Z)-4-methoxyimino-1-phenylsulfanylhexane-2,5-dione |
| SMILES | CO/N=C(/CC(=O)CSc1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H15NO3S/c1-10(15)13(14-17-2)8-11(16)9-18-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3/b14-13- |
| InChIKey | PLGZEDMJUHZUGC-YPKPFQOOSA-N |
| XLogP | 2.33 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|