C19H23N5O4 — CID 54130842
(2E)-2-methoxyimino-2-[2-[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-5,6-dimethylpyrimidin-4-yl]oxyphenyl]-N-methylacetamide (PubChem CID 54130842) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2E)-2-methoxyimino-2-[2-[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-5,6-dimethylpyrimidin-4-yl]oxyphenyl]-N-methylacetamide.
| Compound Name | (2E)-2-methoxyimino-2-[2-[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-5,6-dimethylpyrimidin-4-yl]oxyphenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 54130842 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2E)-2-methoxyimino-2-[2-[2-[(Z)-N-methoxy-C-methylcarbonimidoyl]-5,6-dimethylpyrimidin-4-yl]oxyphenyl]-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1Oc1nc(/C(C)=N\OC)nc(C)c1C |
| InChI | InChI=1S/C19H23N5O4/c1-11-12(2)21-17(13(3)23-26-5)22-19(11)28-15-10-8-7-9-14(15)16(24-27-6)18(25)20-4/h7-10H,1-6H3,(H,20,25)/b23-13-,24-16+ |
| InChIKey | CDOUPXRFECGINF-CNWRWBJISA-N |
| XLogP | 2.35 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|