C20H16BrFN4O4 — CID 15835093
(2Z)-2-[2-[6-(2-bromophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 15835093) has the molecular formula C20H16BrFN4O4 and a molecular weight of 475.27 g/mol. Its IUPAC name is (2Z)-2-[2-[6-(2-bromophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2Z)-2-[2-[6-(2-bromophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 15835093 |
| Molecular Formula | C20H16BrFN4O4 |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | (2Z)-2-[2-[6-(2-bromophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N\OC)c1ccccc1Oc1ncnc(Oc2ccccc2Br)c1F |
| InChI | InChI=1S/C20H16BrFN4O4/c1-23-18(27)17(26-28-2)12-7-3-5-9-14(12)29-19-16(22)20(25-11-24-19)30-15-10-6-4-8-13(15)21/h3-11H,1-2H3,(H,23,27)/b26-17- |
| InChIKey | ILWLRRZNDWNRKM-ONUIUJJFSA-N |
| XLogP | 4.06 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|