C19H19Cl2N3O2 — CID 59871403
(2E)-2-[2-[[(E)-1-(4-chlorophenyl)ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylethanimidoyl chloride (PubChem CID 59871403) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is (2E)-2-[2-[[(E)-1-(4-chlorophenyl)ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylethanimidoyl chloride.
| Compound Name | (2E)-2-[2-[[(E)-1-(4-chlorophenyl)ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylethanimidoyl chloride |
|---|---|
| PubChem CID | 59871403 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (2E)-2-[2-[[(E)-1-(4-chlorophenyl)ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylethanimidoyl chloride |
| SMILES | C/N=C(Cl)/C(=N/OC)c1ccccc1CO/N=C(\C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-13(14-8-10-16(20)11-9-14)23-26-12-15-6-4-5-7-17(15)18(24-25-3)19(21)22-2/h4-11H,12H2,1-3H3/b22-19-,23-13+,24-18+ |
| InChIKey | FBPGMNBIJIZLNE-BEPBYRFBSA-N |
| XLogP | 4.90 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|