C19H21F3N4O3 — CID 137298514
N-amino-2-[3-hydroxy-4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N'-methylethanimidamide (PubChem CID 137298514) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is N-amino-2-[3-hydroxy-4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N'-methylethanimidamide.
| Compound Name | N-amino-2-[3-hydroxy-4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 137298514 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-amino-2-[3-hydroxy-4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N'-methylethanimidamide |
| SMILES | C/N=C(/COc1ccc(/C(C)=N/OCc2ccc(C(F)(F)F)cc2)c(O)c1)NN |
| InChI | InChI=1S/C19H21F3N4O3/c1-12(26-29-10-13-3-5-14(6-4-13)19(20,21)22)16-8-7-15(9-17(16)27)28-11-18(24-2)25-23/h3-9,27H,10-11,23H2,1-2H3,(H,24,25)/b26-12+ |
| InChIKey | PQIXSFYUXTUHHB-RPPGKUMJSA-N |
| XLogP | 3.22 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|