C19H22F3N5O2 — CID 134389236
N-amino-N'-ethyl-2-[[5-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidamide (PubChem CID 134389236) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-amino-N'-ethyl-2-[[5-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidamide.
| Compound Name | N-amino-N'-ethyl-2-[[5-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidamide |
|---|---|
| PubChem CID | 134389236 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-amino-N'-ethyl-2-[[5-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidamide |
| SMILES | CC/N=C(/COc1ccc(/C(C)=N/OCc2ccc(C(F)(F)F)cc2)cn1)NN |
| InChI | InChI=1S/C19H22F3N5O2/c1-3-24-17(26-23)12-28-18-9-6-15(10-25-18)13(2)27-29-11-14-4-7-16(8-5-14)19(20,21)22/h4-10H,3,11-12,23H2,1-2H3,(H,24,26)/b27-13+ |
| InChIKey | VKJQLYUEJLRDFV-UVHMKAGCSA-N |
| XLogP | 3.30 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|