C19H19F3N4O3 — CID 123770471
ethanimidoyl 2-[[5-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidate (PubChem CID 123770471) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is ethanimidoyl 2-[[5-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidate.
| Compound Name | ethanimidoyl 2-[[5-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidate |
|---|---|
| PubChem CID | 123770471 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | ethanimidoyl 2-[[5-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]ethanimidate |
| SMILES | [H]/N=C(/COc1ccc(C(C)=NOCc2ccc(C(F)(F)F)cc2)cn1)O/C(C)=N/[H] |
| InChI | InChI=1S/C19H19F3N4O3/c1-12(26-28-10-14-3-6-16(7-4-14)19(20,21)22)15-5-8-18(25-9-15)27-11-17(24)29-13(2)23/h3-9,23-24H,10-11H2,1-2H3/b23-13+,24-17-,26-12? |
| InChIKey | UBXMLRKJWMSXJW-CBIQPEPESA-N |
| XLogP | 4.41 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|