C20H23F3N6O2 — CID 118954181
1-[6-[(1-propan-2-yl-2,3-dihydrotetrazol-5-yl)methoxy]-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 118954181) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 1-[6-[(1-propan-2-yl-2,3-dihydrotetrazol-5-yl)methoxy]-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | 1-[6-[(1-propan-2-yl-2,3-dihydrotetrazol-5-yl)methoxy]-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 118954181 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-[6-[(1-propan-2-yl-2,3-dihydrotetrazol-5-yl)methoxy]-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | CC(=NOCc1ccc(C(F)(F)F)cc1)c1ccc(OCC2=NNNN2C(C)C)nc1 |
| InChI | InChI=1S/C20H23F3N6O2/c1-13(2)29-18(25-27-28-29)12-30-19-9-6-16(10-24-19)14(3)26-31-11-15-4-7-17(8-5-15)20(21,22)23/h4-10,13,27-28H,11-12H2,1-3H3 |
| InChIKey | VGFZCIVOYLFQMK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|