C18H19F3N6O3 — CID 134389241
(E)-1-[6-(2,3-dihydro-1H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 134389241) has the molecular formula C18H19F3N6O3 and a molecular weight of 424.38 g/mol. Its IUPAC name is (E)-1-[6-(2,3-dihydro-1H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-1-[6-(2,3-dihydro-1H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 134389241 |
| Molecular Formula | C18H19F3N6O3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (E)-1-[6-(2,3-dihydro-1H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | COc1cc(CO/N=C(\C)c2ccc(OCC3=NNNN3)nc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H19F3N6O3/c1-11(13-4-6-17(22-8-13)29-10-16-23-26-27-24-16)25-30-9-12-3-5-14(18(19,20)21)15(7-12)28-2/h3-8,26-27H,9-10H2,1-2H3,(H,23,24)/b25-11+ |
| InChIKey | ZHQVJUJKSPBFSU-OPEKNORGSA-N |
| XLogP | 2.35 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|