C21H19F3N2O6 — CID 118238876
5-[[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]methyl]-1,3-oxazolidine-2,4-dione (PubChem CID 118238876) has the molecular formula C21H19F3N2O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 5-[[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]methyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]methyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 118238876 |
| Molecular Formula | C21H19F3N2O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-[[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]methyl]-1,3-oxazolidine-2,4-dione |
| SMILES | COc1cc(CO/N=C(\C)c2ccc(OCC3OC(=O)NC3=O)cc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C21H19F3N2O6/c1-12(26-31-10-13-3-8-16(21(22,23)24)17(9-13)29-2)14-4-6-15(7-5-14)30-11-18-19(27)25-20(28)32-18/h3-9,18H,10-11H2,1-2H3,(H,25,27,28)/b26-12+ |
| InChIKey | RBJZTSJUGPMGMJ-RPPGKUMJSA-N |
| XLogP | 3.67 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|