C19H21F3N4O3 — CID 134389071
N'-amino-2-[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]ethanimidamide (PubChem CID 134389071) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is N'-amino-2-[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]ethanimidamide.
| Compound Name | N'-amino-2-[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]ethanimidamide |
|---|---|
| PubChem CID | 134389071 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N'-amino-2-[4-[(E)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenoxy]ethanimidamide |
| SMILES | COc1cc(CO/N=C(\C)c2ccc(OC/C(N)=N/N)cc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N4O3/c1-12(14-4-6-15(7-5-14)28-11-18(23)25-24)26-29-10-13-3-8-16(19(20,21)22)17(9-13)27-2/h3-9H,10-11,24H2,1-2H3,(H2,23,25)/b26-12+ |
| InChIKey | GFTSIOKVXPJXMX-RPPGKUMJSA-N |
| XLogP | 3.26 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|