About ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate
ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate (PubChem CID 144887514) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate.
Molecular Properties
| Compound Name | ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate |
| PubChem CID | 144887514 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate |
| SMILES | [H]/N=C(/COc1ccc(/C(C)=N/[H])cn1)O/C(C)=N/[H] |
| InChI | InChI=1S/C11H14N4O2/c1-7(12)9-3-4-11(15-5-9)16-6-10(14)17-8(2)13/h3-5,12-14H,6H2,1-2H3/b12-7+,13-8+,14-10- |
| InChIKey | LWOAOHCKAINNKC-YEOMYCFLSA-N |
| XLogP | 1.84 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate?
The IUPAC name of ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate (CID 144887514) is ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate.
What is the SMILES notation for ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate?
The canonical SMILES for ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate is [H]/N=C(/COc1ccc(/C(C)=N/[H])cn1)O/C(C)=N/[H].
What is the InChIKey of ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate?
The InChIKey is LWOAOHCKAINNKC-YEOMYCFLSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-7(12)9-3-4-11(15-5-9)16-6-10(14)17-8(2)13/h3-5,12-14H,6H2,1-2H3/b12-7+,13-8+,14-10-.
What are the key properties of ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate?
ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate has a molecular weight of 234.26 g/mol, XLogP of 1.84, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidoyl 2-[(5-ethanimidoyl-2-pyridinyl)oxy]ethanimidate is sourced from PubChem (CID 144887514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).