C19H15F9N2O3S — CID 143205663
N-[2-[(E)-N-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143205663) has the molecular formula C19H15F9N2O3S and a molecular weight of 522.39 g/mol. Its IUPAC name is N-[2-[(E)-N-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(E)-N-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143205663 |
| Molecular Formula | C19H15F9N2O3S |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-[2-[(E)-N-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C/C(=N\OCc1ccc(C(F)(F)F)cc1C(F)(F)F)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H15F9N2O3S/c1-10-3-6-16(30-34(31,32)19(26,27)28)14(7-10)11(2)29-33-9-12-4-5-13(17(20,21)22)8-15(12)18(23,24)25/h3-8,30H,9H2,1-2H3/b29-11+ |
| InChIKey | WNCJVIIUSWKFKL-VPUKRXIYSA-N |
| XLogP | 6.23 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|