C16H14ClF3N2O3S — CID 91544664
N-[4-chloro-2-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 91544664) has the molecular formula C16H14ClF3N2O3S and a molecular weight of 406.81 g/mol. Its IUPAC name is N-[4-chloro-2-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 91544664 |
| Molecular Formula | C16H14ClF3N2O3S |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-[4-chloro-2-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(=NOCc1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14ClF3N2O3S/c1-11(21-25-10-12-5-3-2-4-6-12)14-9-13(17)7-8-15(14)22-26(23,24)16(18,19)20/h2-9,22H,10H2,1H3 |
| InChIKey | CFUHRBMIPZIIJX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|