C22H28F6N2O3S — CID 143205572
ethane;1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methanesulfonamide (PubChem CID 143205572) has the molecular formula C22H28F6N2O3S and a molecular weight of 514.53 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methanesulfonamide.
| Compound Name | ethane;1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 143205572 |
| Molecular Formula | C22H28F6N2O3S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | ethane;1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methanesulfonamide |
| SMILES | C/C(=N\OCc1ccccc1C(F)(F)F)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C18H16F6N2O3S.2C2H6/c1-11-7-8-16(26-30(27,28)18(22,23)24)14(9-11)12(2)25-29-10-13-5-3-4-6-15(13)17(19,20)21;2*1-2/h3-9,26H,10H2,1-2H3;2*1-2H3/b25-12+;; |
| InChIKey | NLUQPYNIAUTJTE-QGLHITIPSA-N |
| XLogP | 7.27 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|