C23H18F3N3O3S — CID 143205687
N-[2-[(E)-N-[(4-cyanophenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 143205687) has the molecular formula C23H18F3N3O3S and a molecular weight of 473.48 g/mol. Its IUPAC name is N-[2-[(E)-N-[(4-cyanophenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(E)-N-[(4-cyanophenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 143205687 |
| Molecular Formula | C23H18F3N3O3S |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[2-[(E)-N-[(4-cyanophenyl)methoxy]-C-phenylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C(F)(F)F)c(/C(=N/OCc2ccc(C#N)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H18F3N3O3S/c1-16-7-12-21(29-33(30,31)23(24,25)26)20(13-16)22(19-5-3-2-4-6-19)28-32-15-18-10-8-17(14-27)9-11-18/h2-13,29H,15H2,1H3/b28-22+ |
| InChIKey | PPSDESSLYYGFAS-XAYXJRQQSA-N |
| XLogP | 5.10 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|