C18H19F3N2O3S — CID 143205484
1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-phenyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide (PubChem CID 143205484) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-phenyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-phenyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 143205484 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-phenyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C(F)(F)F)c(/C(=N/OC(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19F3N2O3S/c1-12(2)26-22-17(14-7-5-4-6-8-14)15-11-13(3)9-10-16(15)23-27(24,25)18(19,20)21/h4-12,23H,1-3H3/b22-17+ |
| InChIKey | JXKDPEPHMDPRIE-OQKWZONESA-N |
| XLogP | 4.43 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|