C13H17F3N2O3S — CID 143205486
1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide (PubChem CID 143205486) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 143205486 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-methyl-2-[(E)-C-methyl-N-propan-2-yloxycarbonimidoyl]phenyl]methanesulfonamide |
| SMILES | C/C(=N\OC(C)C)c1cc(C)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O3S/c1-8(2)21-17-10(4)11-7-9(3)5-6-12(11)18-22(19,20)13(14,15)16/h5-8,18H,1-4H3/b17-10+ |
| InChIKey | VDWPQCBBHVYMNY-LICLKQGHSA-N |
| XLogP | 3.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|