C12H10ClF3N2O3S — CID 91306337
N-[4-chloro-2-(C-methyl-N-prop-2-ynoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 91306337) has the molecular formula C12H10ClF3N2O3S and a molecular weight of 354.74 g/mol. Its IUPAC name is N-[4-chloro-2-(C-methyl-N-prop-2-ynoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-(C-methyl-N-prop-2-ynoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 91306337 |
| Molecular Formula | C12H10ClF3N2O3S |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[4-chloro-2-(C-methyl-N-prop-2-ynoxycarbonimidoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C#CCON=C(C)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2O3S/c1-3-6-21-17-8(2)10-7-9(13)4-5-11(10)18-22(19,20)12(14,15)16/h1,4-5,7,18H,6H2,2H3 |
| InChIKey | GTUOMJISEGSSBP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|