C12H11ClF6N2O3S — CID 91037463
N-[4-chloro-2-[C-ethyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 91037463) has the molecular formula C12H11ClF6N2O3S and a molecular weight of 412.74 g/mol. Its IUPAC name is N-[4-chloro-2-[C-ethyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-[C-ethyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 91037463 |
| Molecular Formula | C12H11ClF6N2O3S |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N-[4-chloro-2-[C-ethyl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC(=NOCC(F)(F)F)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF6N2O3S/c1-2-9(20-24-6-11(14,15)16)8-5-7(13)3-4-10(8)21-25(22,23)12(17,18)19/h3-5,21H,2,6H2,1H3 |
| InChIKey | XTBZIHRNISKGJP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|