C17H16ClF3N2O3S — CID 59021081
N-[4-chloro-2-[(E)-C-ethyl-N-(4-methylphenoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 59021081) has the molecular formula C17H16ClF3N2O3S and a molecular weight of 420.84 g/mol. Its IUPAC name is N-[4-chloro-2-[(E)-C-ethyl-N-(4-methylphenoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-[(E)-C-ethyl-N-(4-methylphenoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 59021081 |
| Molecular Formula | C17H16ClF3N2O3S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[4-chloro-2-[(E)-C-ethyl-N-(4-methylphenoxy)carbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC/C(=N\Oc1ccc(C)cc1)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H16ClF3N2O3S/c1-3-15(22-26-13-7-4-11(2)5-8-13)14-10-12(18)6-9-16(14)23-27(24,25)17(19,20)21/h4-10,23H,3H2,1-2H3/b22-15+ |
| InChIKey | BKVATKMJSZAEIH-PXLXIMEGSA-N |
| XLogP | 5.10 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|